C29H32F3N7O3 — CID 121359306
N-[2-[[(3R)-6,6-dimethyloxan-3-yl]methoxy]pyrimidin-5-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide (PubChem CID 121359306) has the molecular formula C29H32F3N7O3 and a molecular weight of 583.62 g/mol. Its IUPAC name is N-[2-[[(3R)-6,6-dimethyloxan-3-yl]methoxy]pyrimidin-5-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide.
| Compound Name | N-[2-[[(3R)-6,6-dimethyloxan-3-yl]methoxy]pyrimidin-5-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359306 |
| Molecular Formula | C29H32F3N7O3 |
| Molecular Weight | 583.62 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | N-[2-[[(3R)-6,6-dimethyloxan-3-yl]methoxy]pyrimidin-5-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
| SMILES | CC1(C)CC[C@@H](COc2ncc(NC(=O)N3c4nc(-c5cccc(C(F)(F)F)c5)ncc4N4CCCC3C4)cn2)CO1 |
| InChI | InChI=1S/C29H32F3N7O3/c1-28(2)9-8-18(17-42-28)16-41-26-34-12-21(13-35-26)36-27(40)39-22-7-4-10-38(15-22)23-14-33-24(37-25(23)39)19-5-3-6-20(11-19)29(30,31)32/h3,5-6,11-14,18,22H,4,7-10,15-17H2,1-2H3,(H,36,40)/t18-,22?/m0/s1 |
| InChIKey | AZPCVIUKHFJPEE-HXBUSHRASA-N |
| XLogP | 5.56 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |