C26H28F3N7O3 — CID 162597955
N-[4-[(2R)-3-methoxy-2-methylpropoxy]pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide (PubChem CID 162597955) has the molecular formula C26H28F3N7O3 and a molecular weight of 543.55 g/mol. Its IUPAC name is N-[4-[(2R)-3-methoxy-2-methylpropoxy]pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide.
| Compound Name | N-[4-[(2R)-3-methoxy-2-methylpropoxy]pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 162597955 |
| Molecular Formula | C26H28F3N7O3 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | N-[4-[(2R)-3-methoxy-2-methylpropoxy]pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
| SMILES | COC[C@@H](C)COc1ccnc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ncc3N3CCCC2C3)n1 |
| InChI | InChI=1S/C26H28F3N7O3/c1-16(14-38-2)15-39-21-8-9-30-24(32-21)34-25(37)36-19-7-4-10-35(13-19)20-12-31-22(33-23(20)36)17-5-3-6-18(11-17)26(27,28)29/h3,5-6,8-9,11-12,16,19H,4,7,10,13-15H2,1-2H3,(H,30,32,34,37)/t16-,19?/m1/s1 |
| InChIKey | ULNJGHNIEGOCLQ-VTBWFHPJSA-N |
| XLogP | 4.63 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |