C23H22F3N7O4 — CID 121359414
(9S)-N-[4-[(2S)-2,3-dihydroxypropoxy]pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121359414) has the molecular formula C23H22F3N7O4 and a molecular weight of 517.47 g/mol. Its IUPAC name is (9S)-N-[4-[(2S)-2,3-dihydroxypropoxy]pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-N-[4-[(2S)-2,3-dihydroxypropoxy]pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359414 |
| Molecular Formula | C23H22F3N7O4 |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (9S)-N-[4-[(2S)-2,3-dihydroxypropoxy]pyrimidin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1nccc(OC[C@@H](O)CO)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)ncc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C23H22F3N7O4/c24-23(25,26)14-3-1-2-13(8-14)19-28-9-17-20(30-19)33(15-5-7-32(17)10-15)22(36)31-21-27-6-4-18(29-21)37-12-16(35)11-34/h1-4,6,8-9,15-16,34-35H,5,7,10-12H2,(H,27,29,31,36)/t15-,16-/m0/s1 |
| InChIKey | ANVOJHXZQCBKKS-HOTGVXAUSA-N |
| XLogP | 2.32 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |