C25H26F3N7O4 — CID 121351810
(9S)-N-[4-(2,3-dihydroxypropoxy)pyrimidin-2-yl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide (PubChem CID 121351810) has the molecular formula C25H26F3N7O4 and a molecular weight of 545.52 g/mol. Its IUPAC name is (9S)-N-[4-(2,3-dihydroxypropoxy)pyrimidin-2-yl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-N-[4-(2,3-dihydroxypropoxy)pyrimidin-2-yl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121351810 |
| Molecular Formula | C25H26F3N7O4 |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | (9S)-N-[4-(2,3-dihydroxypropoxy)pyrimidin-2-yl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
| SMILES | Cc1nc(-c2cccc(C(F)(F)F)c2)nc2c1N1CCC[C@@H](C1)N2C(=O)Nc1nccc(OCC(O)CO)n1 |
| InChI | InChI=1S/C25H26F3N7O4/c1-14-20-22(32-21(30-14)15-4-2-5-16(10-15)25(26,27)28)35(17-6-3-9-34(20)11-17)24(38)33-23-29-8-7-19(31-23)39-13-18(37)12-36/h2,4-5,7-8,10,17-18,36-37H,3,6,9,11-13H2,1H3,(H,29,31,33,38)/t17-,18?/m0/s1 |
| InChIKey | JUKXHQIIEGELMG-ZENAZSQFSA-N |
| XLogP | 3.01 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |