C26H27F3N6O4 — CID 135370686
(9S)-N-[5-(2,3-dihydroxypropoxy)-2-pyridinyl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide (PubChem CID 135370686) has the molecular formula C26H27F3N6O4 and a molecular weight of 544.53 g/mol. Its IUPAC name is (9S)-N-[5-(2,3-dihydroxypropoxy)-2-pyridinyl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-N-[5-(2,3-dihydroxypropoxy)-2-pyridinyl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 135370686 |
| Molecular Formula | C26H27F3N6O4 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | (9S)-N-[5-(2,3-dihydroxypropoxy)-2-pyridinyl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
| SMILES | Cc1nc(-c2cccc(C(F)(F)F)c2)nc2c1N1CCC[C@@H](C1)N2C(=O)Nc1ccc(OCC(O)CO)cn1 |
| InChI | InChI=1S/C26H27F3N6O4/c1-15-22-24(33-23(31-15)16-4-2-5-17(10-16)26(27,28)29)35(18-6-3-9-34(22)12-18)25(38)32-21-8-7-20(11-30-21)39-14-19(37)13-36/h2,4-5,7-8,10-11,18-19,36-37H,3,6,9,12-14H2,1H3,(H,30,32,38)/t18-,19?/m0/s1 |
| InChIKey | GOMRHKQQCQQRBI-OYKVQYDMSA-N |
| XLogP | 3.62 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |