C24H24F3N7O4 — CID 140938724
N-[6-[(2R)-2,3-dihydroxypropoxy]pyridazin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide (PubChem CID 140938724) has the molecular formula C24H24F3N7O4 and a molecular weight of 531.50 g/mol. Its IUPAC name is N-[6-[(2R)-2,3-dihydroxypropoxy]pyridazin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide.
| Compound Name | N-[6-[(2R)-2,3-dihydroxypropoxy]pyridazin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 140938724 |
| Molecular Formula | C24H24F3N7O4 |
| Molecular Weight | 531.50 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | N-[6-[(2R)-2,3-dihydroxypropoxy]pyridazin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1cnnc(OC[C@H](O)CO)c1)N1c2nc(-c3cccc(C(F)(F)F)c3)ncc2N2CCCC1C2 |
| InChI | InChI=1S/C24H24F3N7O4/c25-24(26,27)15-4-1-3-14(7-15)21-28-10-19-22(31-21)34(17-5-2-6-33(19)11-17)23(37)30-16-8-20(32-29-9-16)38-13-18(36)12-35/h1,3-4,7-10,17-18,35-36H,2,5-6,11-13H2,(H,30,32,37)/t17?,18-/m1/s1 |
| InChIKey | WMEYPCSALQUCAF-QRWMCTBCSA-N |
| XLogP | 2.71 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |