C25H24F3N7O3 — CID 121359314
(9S)-N-[2-(oxan-4-yloxy)pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121359314) has the molecular formula C25H24F3N7O3 and a molecular weight of 527.51 g/mol. Its IUPAC name is (9S)-N-[2-(oxan-4-yloxy)pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-N-[2-(oxan-4-yloxy)pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359314 |
| Molecular Formula | C25H24F3N7O3 |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | (9S)-N-[2-(oxan-4-yloxy)pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1ccnc(OC2CCOCC2)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)ncc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C25H24F3N7O3/c26-25(27,28)16-3-1-2-15(12-16)21-30-13-19-22(33-21)35(17-5-9-34(19)14-17)24(36)32-20-4-8-29-23(31-20)38-18-6-10-37-11-7-18/h1-4,8,12-13,17-18H,5-7,9-11,14H2,(H,29,31,32,36)/t17-/m0/s1 |
| InChIKey | BDUNRQXHDQTHFT-KRWDZBQOSA-N |
| XLogP | 4.14 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |