C17H16BrN5O2 — CID 121357981
5-acetyl-N-(4-bromo-2-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121357981) has the molecular formula C17H16BrN5O2 and a molecular weight of 402.25 g/mol. Its IUPAC name is 5-acetyl-N-(4-bromo-2-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | 5-acetyl-N-(4-bromo-2-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121357981 |
| Molecular Formula | C17H16BrN5O2 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 5-acetyl-N-(4-bromo-2-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(Br)ccn1)C1CCN2C1 |
| InChI | InChI=1S/C17H16BrN5O2/c1-10(24)13-2-3-14-16(20-13)23(12-5-7-22(14)9-12)17(25)21-15-8-11(18)4-6-19-15/h2-4,6,8,12H,5,7,9H2,1H3,(H,19,21,25) |
| InChIKey | RLGXYUQZQQHFEI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |