C16H18N6O2S — CID 145084161
5-N-ethyl-8-N-(1,2-thiazol-3-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 145084161) has the molecular formula C16H18N6O2S and a molecular weight of 358.43 g/mol. Its IUPAC name is 5-N-ethyl-8-N-(1,2-thiazol-3-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 5-N-ethyl-8-N-(1,2-thiazol-3-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 145084161 |
| Molecular Formula | C16H18N6O2S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 5-N-ethyl-8-N-(1,2-thiazol-3-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | CCNC(=O)c1ccc2c(n1)N(C(=O)Nc1ccsn1)C1CCN2C1 |
| InChI | InChI=1S/C16H18N6O2S/c1-2-17-15(23)11-3-4-12-14(18-11)22(10-5-7-21(12)9-10)16(24)19-13-6-8-25-20-13/h3-4,6,8,10H,2,5,7,9H2,1H3,(H,17,23)(H,19,20,24) |
| InChIKey | ICJZUXCXXPIDCP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |