C18H19N7O2 — CID 140824596
5-N-cyclopropyl-8-N-pyridazin-3-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 140824596) has the molecular formula C18H19N7O2 and a molecular weight of 365.40 g/mol. Its IUPAC name is 5-N-cyclopropyl-8-N-pyridazin-3-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 5-N-cyclopropyl-8-N-pyridazin-3-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 140824596 |
| Molecular Formula | C18H19N7O2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 5-N-cyclopropyl-8-N-pyridazin-3-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | O=C(NC1CC1)c1ccc2c(n1)N(C(=O)Nc1cccnn1)C1CCN2C1 |
| InChI | InChI=1S/C18H19N7O2/c26-17(20-11-3-4-11)13-5-6-14-16(21-13)25(12-7-9-24(14)10-12)18(27)22-15-2-1-8-19-23-15/h1-2,5-6,8,11-12H,3-4,7,9-10H2,(H,20,26)(H,22,23,27) |
| InChIKey | VOEPATKTVWBTMU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |