C24H33N7O — CID 155001845
5-[1-(ethylamino)ethenyl]-N-[6-[(3R)-3-methylpentyl]pyrazin-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 155001845) has the molecular formula C24H33N7O and a molecular weight of 435.58 g/mol. Its IUPAC name is 5-[1-(ethylamino)ethenyl]-N-[6-[(3R)-3-methylpentyl]pyrazin-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | 5-[1-(ethylamino)ethenyl]-N-[6-[(3R)-3-methylpentyl]pyrazin-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 155001845 |
| Molecular Formula | C24H33N7O |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 5-[1-(ethylamino)ethenyl]-N-[6-[(3R)-3-methylpentyl]pyrazin-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | C=C(NCC)c1ccc2c(n1)N(C(=O)Nc1cncc(CC[C@H](C)CC)n1)C1CCN2C1 |
| InChI | InChI=1S/C24H33N7O/c1-5-16(3)7-8-18-13-25-14-22(27-18)29-24(32)31-19-11-12-30(15-19)21-10-9-20(28-23(21)31)17(4)26-6-2/h9-10,13-14,16,19,26H,4-8,11-12,15H2,1-3H3,(H,27,29,32)/t16-,19?/m1/s1 |
| InChIKey | SMWBWKLZVUHBIB-VTBWFHPJSA-N |
| XLogP | 4.06 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |