C20H23F3N6OS — CID 118974559
(6R)-N-(5-methyl-1,3-thiazol-2-yl)-10-[3-(trifluoromethyl)piperidin-1-yl]-2,7,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide (PubChem CID 118974559) has the molecular formula C20H23F3N6OS and a molecular weight of 452.51 g/mol. Its IUPAC name is (6R)-N-(5-methyl-1,3-thiazol-2-yl)-10-[3-(trifluoromethyl)piperidin-1-yl]-2,7,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide.
| Compound Name | (6R)-N-(5-methyl-1,3-thiazol-2-yl)-10-[3-(trifluoromethyl)piperidin-1-yl]-2,7,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide |
|---|---|
| PubChem CID | 118974559 |
| Molecular Formula | C20H23F3N6OS |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (6R)-N-(5-methyl-1,3-thiazol-2-yl)-10-[3-(trifluoromethyl)piperidin-1-yl]-2,7,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-7-carboxamide |
| SMILES | Cc1cnc(NC(=O)N2c3nc(N4CCCC(C(F)(F)F)C4)ccc3N3CCC[C@H]32)s1 |
| InChI | InChI=1S/C20H23F3N6OS/c1-12-10-24-18(31-12)26-19(30)29-16-5-3-9-28(16)14-6-7-15(25-17(14)29)27-8-2-4-13(11-27)20(21,22)23/h6-7,10,13,16H,2-5,8-9,11H2,1H3,(H,24,26,30)/t13?,16-/m1/s1 |
| InChIKey | BATMWHHEJLEGRE-FQNRMIAFSA-N |
| XLogP | 4.60 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |