C26H29F3N6O2 — CID 130437323
1-ethyl-N-[3-(1,3-oxazol-5-yl)phenyl]-7-[(3R)-3-(trifluoromethyl)piperidin-1-yl]-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 130437323) has the molecular formula C26H29F3N6O2 and a molecular weight of 514.55 g/mol. Its IUPAC name is 1-ethyl-N-[3-(1,3-oxazol-5-yl)phenyl]-7-[(3R)-3-(trifluoromethyl)piperidin-1-yl]-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | 1-ethyl-N-[3-(1,3-oxazol-5-yl)phenyl]-7-[(3R)-3-(trifluoromethyl)piperidin-1-yl]-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 130437323 |
| Molecular Formula | C26H29F3N6O2 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 1-ethyl-N-[3-(1,3-oxazol-5-yl)phenyl]-7-[(3R)-3-(trifluoromethyl)piperidin-1-yl]-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | CCN1CCCN(C(=O)Nc2cccc(-c3cnco3)c2)c2nc(N3CCC[C@@H](C(F)(F)F)C3)ccc21 |
| InChI | InChI=1S/C26H29F3N6O2/c1-2-33-12-5-13-35(25(36)31-20-8-3-6-18(14-20)22-15-30-17-37-22)24-21(33)9-10-23(32-24)34-11-4-7-19(16-34)26(27,28)29/h3,6,8-10,14-15,17,19H,2,4-5,7,11-13,16H2,1H3,(H,31,36)/t19-/m1/s1 |
| InChIKey | VNWRAFVWKQEGHT-LJQANCHMSA-N |
| XLogP | 5.78 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |