C26H23F3N6O3 — CID 130437499
(9R,10R)-10-hydroxy-5-[(2E,4E)-5-(methylideneamino)-4-(trifluoromethyl)penta-2,4-dien-2-yl]-N-[3-(1,3-oxazol-5-yl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 130437499) has the molecular formula C26H23F3N6O3 and a molecular weight of 524.50 g/mol. Its IUPAC name is (9R,10R)-10-hydroxy-5-[(2E,4E)-5-(methylideneamino)-4-(trifluoromethyl)penta-2,4-dien-2-yl]-N-[3-(1,3-oxazol-5-yl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9R,10R)-10-hydroxy-5-[(2E,4E)-5-(methylideneamino)-4-(trifluoromethyl)penta-2,4-dien-2-yl]-N-[3-(1,3-oxazol-5-yl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 130437499 |
| Molecular Formula | C26H23F3N6O3 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | (9R,10R)-10-hydroxy-5-[(2E,4E)-5-(methylideneamino)-4-(trifluoromethyl)penta-2,4-dien-2-yl]-N-[3-(1,3-oxazol-5-yl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | C=N/C=C(\C=C(/C)c1ccc2c(n1)N(C(=O)Nc1cccc(-c3cnco3)c1)[C@@H]1CN2C[C@H]1O)C(F)(F)F |
| InChI | InChI=1S/C26H23F3N6O3/c1-15(8-17(10-30-2)26(27,28)29)19-6-7-20-24(33-19)35(21-12-34(20)13-22(21)36)25(37)32-18-5-3-4-16(9-18)23-11-31-14-38-23/h3-11,14,21-22,36H,2,12-13H2,1H3,(H,32,37)/b15-8+,17-10+/t21-,22-/m1/s1 |
| InChIKey | RKFQEFCEHBPEFN-ZZMWQHEVSA-N |
| XLogP | 4.89 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|