C22H28N6O — CID 153196751
(9R)-5-(3-methylpiperidin-1-yl)-N-pyridin-2-yl-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 153196751) has the molecular formula C22H28N6O and a molecular weight of 392.51 g/mol. Its IUPAC name is (9R)-5-(3-methylpiperidin-1-yl)-N-pyridin-2-yl-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9R)-5-(3-methylpiperidin-1-yl)-N-pyridin-2-yl-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 153196751 |
| Molecular Formula | C22H28N6O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | (9R)-5-(3-methylpiperidin-1-yl)-N-pyridin-2-yl-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | CC1CCCN(c2ccc3c(n2)N(C(=O)Nc2ccccn2)[C@@H]2CCCN3C2)C1 |
| InChI | InChI=1S/C22H28N6O/c1-16-6-4-13-27(14-16)20-10-9-18-21(25-20)28(17-7-5-12-26(18)15-17)22(29)24-19-8-2-3-11-23-19/h2-3,8-11,16-17H,4-7,12-15H2,1H3,(H,23,24,29)/t16?,17-/m1/s1 |
| InChIKey | WJCWZEDWEHREFR-ZYMOGRSISA-N |
| XLogP | 3.73 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |