C21H21F3N6O4 — CID 121358104
methyl 2-[[5-[[(2R)-1,1,1-trifluoropropan-2-yl]carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]pyridine-4-carboxylate (PubChem CID 121358104) has the molecular formula C21H21F3N6O4 and a molecular weight of 478.43 g/mol. Its IUPAC name is methyl 2-[[5-[[(2R)-1,1,1-trifluoropropan-2-yl]carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]pyridine-4-carboxylate.
| Compound Name | methyl 2-[[5-[[(2R)-1,1,1-trifluoropropan-2-yl]carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 121358104 |
| Molecular Formula | C21H21F3N6O4 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | methyl 2-[[5-[[(2R)-1,1,1-trifluoropropan-2-yl]carbamoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(NC(=O)N2c3nc(C(=O)N[C@H](C)C(F)(F)F)ccc3N3CCC2C3)c1 |
| InChI | InChI=1S/C21H21F3N6O4/c1-11(21(22,23)24)26-18(31)14-3-4-15-17(27-14)30(13-6-8-29(15)10-13)20(33)28-16-9-12(5-7-25-16)19(32)34-2/h3-5,7,9,11,13H,6,8,10H2,1-2H3,(H,26,31)(H,25,28,33)/t11-,13?/m1/s1 |
| InChIKey | AOXSRMBKDTUMBY-JTDNENJMSA-N |
| XLogP | 2.57 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |