C19H19ClFN5O2 — CID 121358981
3-amino-N-[(5-chloro-3-fluoro-2-pyridinyl)methyl]-6-methyl-5-[2-[(Z)-prop-1-enoxy]but-3-yn-2-yl]pyrazine-2-carboxamide (PubChem CID 121358981) has the molecular formula C19H19ClFN5O2 and a molecular weight of 403.85 g/mol. Its IUPAC name is 3-amino-N-[(5-chloro-3-fluoro-2-pyridinyl)methyl]-6-methyl-5-[2-[(Z)-prop-1-enoxy]but-3-yn-2-yl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[(5-chloro-3-fluoro-2-pyridinyl)methyl]-6-methyl-5-[2-[(Z)-prop-1-enoxy]but-3-yn-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 121358981 |
| Molecular Formula | C19H19ClFN5O2 |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 3-amino-N-[(5-chloro-3-fluoro-2-pyridinyl)methyl]-6-methyl-5-[2-[(Z)-prop-1-enoxy]but-3-yn-2-yl]pyrazine-2-carboxamide |
| SMILES | C#CC(C)(O/C=C\C)c1nc(N)c(C(=O)NCc2ncc(Cl)cc2F)nc1C |
| InChI | InChI=1S/C19H19ClFN5O2/c1-5-7-28-19(4,6-2)16-11(3)25-15(17(22)26-16)18(27)24-10-14-13(21)8-12(20)9-23-14/h2,5,7-9H,10H2,1,3-4H3,(H2,22,26)(H,24,27)/b7-5- |
| InChIKey | LKZUYRYZXJJOQE-ALCCZGGFSA-N |
| XLogP | 2.88 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|