C32H55NO4 — CID 121360495
2-[3-[[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propyl-hydroxyamino]acetic acid (PubChem CID 121360495) has the molecular formula C32H55NO4 and a molecular weight of 517.80 g/mol. Its IUPAC name is 2-[3-[[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propyl-hydroxyamino]acetic acid.
| Compound Name | 2-[3-[[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propyl-hydroxyamino]acetic acid |
|---|---|
| PubChem CID | 121360495 |
| Molecular Formula | C32H55NO4 |
| Molecular Weight | 517.80 g/mol |
| Exact Mass | 517.41 |
| IUPAC Name | 2-[3-[[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propyl-hydroxyamino]acetic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4C[C@@H](OCCCN(O)CC(=O)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C32H55NO4/c1-22(2)8-6-9-23(3)27-12-13-28-26-11-10-24-20-25(37-19-7-18-33(36)21-30(34)35)14-16-31(24,4)29(26)15-17-32(27,28)5/h10,22-23,25-29,36H,6-9,11-21H2,1-5H3,(H,34,35)/t23-,25+,26?,27-,28?,29?,31+,32-/m1/s1 |
| InChIKey | GRGHBVBGZBLMHP-PNJUYXLKSA-N |
| XLogP | 7.58 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.80 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|