C32H54O4S — CID 123606636
2-[3-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propylsulfinyl]acetic acid (PubChem CID 123606636) has the molecular formula C32H54O4S and a molecular weight of 534.85 g/mol. Its IUPAC name is 2-[3-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propylsulfinyl]acetic acid.
| Compound Name | 2-[3-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propylsulfinyl]acetic acid |
|---|---|
| PubChem CID | 123606636 |
| Molecular Formula | C32H54O4S |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | 2-[3-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propylsulfinyl]acetic acid |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OCCCS(=O)CC(=O)O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C32H54O4S/c1-22(2)8-6-9-23(3)27-12-13-28-26-11-10-24-20-25(36-18-7-19-37(35)21-30(33)34)14-16-31(24,4)29(26)15-17-32(27,28)5/h10,22-23,25-29H,6-9,11-21H2,1-5H3,(H,33,34) |
| InChIKey | NDZGYWSLWKKQIO-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|