C19H15F2N3O2 — CID 121361824
3,3-difluoro-4-[(1S)-1-hydroxyethyl]-1-(quinoxalin-6-ylmethyl)indol-2-one (PubChem CID 121361824) has the molecular formula C19H15F2N3O2 and a molecular weight of 355.34 g/mol. Its IUPAC name is 3,3-difluoro-4-[(1S)-1-hydroxyethyl]-1-(quinoxalin-6-ylmethyl)indol-2-one.
| Compound Name | 3,3-difluoro-4-[(1S)-1-hydroxyethyl]-1-(quinoxalin-6-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 121361824 |
| Molecular Formula | C19H15F2N3O2 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 3,3-difluoro-4-[(1S)-1-hydroxyethyl]-1-(quinoxalin-6-ylmethyl)indol-2-one |
| SMILES | C[C@H](O)c1cccc2c1C(F)(F)C(=O)N2Cc1ccc2nccnc2c1 |
| InChI | InChI=1S/C19H15F2N3O2/c1-11(25)13-3-2-4-16-17(13)19(20,21)18(26)24(16)10-12-5-6-14-15(9-12)23-8-7-22-14/h2-9,11,25H,10H2,1H3/t11-/m0/s1 |
| InChIKey | QXLJWWDCGTXCJN-NSHDSACASA-N |
| XLogP | 3.32 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |