C16H13ClF2N2O2 — CID 121361823
1-[(6-chloro-3-pyridinyl)methyl]-3,3-difluoro-4-[(1S)-1-hydroxyethyl]indol-2-one (PubChem CID 121361823) has the molecular formula C16H13ClF2N2O2 and a molecular weight of 338.74 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-3,3-difluoro-4-[(1S)-1-hydroxyethyl]indol-2-one.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-3,3-difluoro-4-[(1S)-1-hydroxyethyl]indol-2-one |
|---|---|
| PubChem CID | 121361823 |
| Molecular Formula | C16H13ClF2N2O2 |
| Molecular Weight | 338.74 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-3,3-difluoro-4-[(1S)-1-hydroxyethyl]indol-2-one |
| SMILES | C[C@H](O)c1cccc2c1C(F)(F)C(=O)N2Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H13ClF2N2O2/c1-9(22)11-3-2-4-12-14(11)16(18,19)15(23)21(12)8-10-5-6-13(17)20-7-10/h2-7,9,22H,8H2,1H3/t9-/m0/s1 |
| InChIKey | VNIXJRMYUIOIQJ-VIFPVBQESA-N |
| XLogP | 3.43 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|