C16H11ClF4N2O2 — CID 121362184
1-[(2-chloro-4-pyridinyl)methyl]-4-(2,2-difluoro-1-hydroxyethyl)-3,3-difluoroindol-2-one (PubChem CID 121362184) has the molecular formula C16H11ClF4N2O2 and a molecular weight of 374.72 g/mol. Its IUPAC name is 1-[(2-chloro-4-pyridinyl)methyl]-4-(2,2-difluoro-1-hydroxyethyl)-3,3-difluoroindol-2-one.
| Compound Name | 1-[(2-chloro-4-pyridinyl)methyl]-4-(2,2-difluoro-1-hydroxyethyl)-3,3-difluoroindol-2-one |
|---|---|
| PubChem CID | 121362184 |
| Molecular Formula | C16H11ClF4N2O2 |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 1-[(2-chloro-4-pyridinyl)methyl]-4-(2,2-difluoro-1-hydroxyethyl)-3,3-difluoroindol-2-one |
| SMILES | O=C1N(Cc2ccnc(Cl)c2)c2cccc(C(O)C(F)F)c2C1(F)F |
| InChI | InChI=1S/C16H11ClF4N2O2/c17-11-6-8(4-5-22-11)7-23-10-3-1-2-9(13(24)14(18)19)12(10)16(20,21)15(23)25/h1-6,13-14,24H,7H2 |
| InChIKey | KYJFFIPESILHKL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|