C16H13F3N2O2 — CID 121362144
3,3-difluoro-1-[(2-fluoro-4-pyridinyl)methyl]-4-[(1R)-1-hydroxyethyl]indol-2-one (PubChem CID 121362144) has the molecular formula C16H13F3N2O2 and a molecular weight of 322.29 g/mol. Its IUPAC name is 3,3-difluoro-1-[(2-fluoro-4-pyridinyl)methyl]-4-[(1R)-1-hydroxyethyl]indol-2-one.
| Compound Name | 3,3-difluoro-1-[(2-fluoro-4-pyridinyl)methyl]-4-[(1R)-1-hydroxyethyl]indol-2-one |
|---|---|
| PubChem CID | 121362144 |
| Molecular Formula | C16H13F3N2O2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 3,3-difluoro-1-[(2-fluoro-4-pyridinyl)methyl]-4-[(1R)-1-hydroxyethyl]indol-2-one |
| SMILES | C[C@@H](O)c1cccc2c1C(F)(F)C(=O)N2Cc1ccnc(F)c1 |
| InChI | InChI=1S/C16H13F3N2O2/c1-9(22)11-3-2-4-12-14(11)16(18,19)15(23)21(12)8-10-5-6-20-13(17)7-10/h2-7,9,22H,8H2,1H3/t9-/m1/s1 |
| InChIKey | ZBTZTHWXKIJCKC-SECBINFHSA-N |
| XLogP | 2.91 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|