About 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile
6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile (PubChem CID 121362151) has the molecular formula C17H13F2N3O2
and a molecular weight of 329.31 g/mol. Its IUPAC name is 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile |
| PubChem CID | 121362151 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile |
| SMILES | C[C@H](O)c1cccc2c1C(F)(F)C(=O)N2Cc1ccc(C#N)cn1 |
| InChI | InChI=1S/C17H13F2N3O2/c1-10(23)13-3-2-4-14-15(13)17(18,19)16(24)22(14)9-12-6-5-11(7-20)8-21-12/h2-6,8,10,23H,9H2,1H3/t10-/m0/s1 |
| InChIKey | YGOGCTWMGDAWLP-JTQLQIEISA-N |
| XLogP | 2.65 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile?
The IUPAC name of 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile (CID 121362151) is 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile?
The canonical SMILES for 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile is C[C@H](O)c1cccc2c1C(F)(F)C(=O)N2Cc1ccc(C#N)cn1.
What is the InChIKey of 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile?
The InChIKey is YGOGCTWMGDAWLP-JTQLQIEISA-N. The full InChI is InChI=1S/C17H13F2N3O2/c1-10(23)13-3-2-4-14-15(13)17(18,19)16(24)22(14)9-12-6-5-11(7-20)8-21-12/h2-6,8,10,23H,9H2,1H3/t10-/m0/s1.
What are the key properties of 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile?
6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile has a molecular weight of 329.31 g/mol, XLogP of 2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[3,3-difluoro-4-[(1S)-1-hydroxyethyl]-2-oxoindol-1-yl]methyl]pyridine-3-carbonitrile is sourced from PubChem (CID 121362151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).