C14H31N2O3S+ — CID 121364164
2-(2-ethoxyethoxy)ethyl-ethyl-dimethylazanium;6-methyl-3,4-dihydrooxathiazine (PubChem CID 121364164) has the molecular formula C14H31N2O3S+ and a molecular weight of 307.48 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl-ethyl-dimethylazanium;6-methyl-3,4-dihydrooxathiazine.
| Compound Name | 2-(2-ethoxyethoxy)ethyl-ethyl-dimethylazanium;6-methyl-3,4-dihydrooxathiazine |
|---|---|
| PubChem CID | 121364164 |
| Molecular Formula | C14H31N2O3S+ |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl-ethyl-dimethylazanium;6-methyl-3,4-dihydrooxathiazine |
| SMILES | CC1=CCNSO1.CCOCCOCC[N+](C)(C)CC |
| InChI | InChI=1S/C10H24NO2.C4H7NOS/c1-5-11(3,4)7-8-13-10-9-12-6-2;1-4-2-3-5-7-6-4/h5-10H2,1-4H3;2,5H,3H2,1H3/q+1; |
| InChIKey | LIYLSEZPGJSQJK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|