C17H11NO2S — CID 121366012
2-methyl-7-phenylthiopyrano[2,3-g][1,3]benzoxazol-9-one (PubChem CID 121366012) has the molecular formula C17H11NO2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-methyl-7-phenylthiopyrano[2,3-g][1,3]benzoxazol-9-one.
| Compound Name | 2-methyl-7-phenylthiopyrano[2,3-g][1,3]benzoxazol-9-one |
|---|---|
| PubChem CID | 121366012 |
| Molecular Formula | C17H11NO2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-methyl-7-phenylthiopyrano[2,3-g][1,3]benzoxazol-9-one |
| SMILES | Cc1nc2ccc3sc(-c4ccccc4)cc(=O)c3c2o1 |
| InChI | InChI=1S/C17H11NO2S/c1-10-18-12-7-8-14-16(17(12)20-10)13(19)9-15(21-14)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | QKCKBDPNKHHDHR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |