C22H25ClN2O2 — CID 121370129
4-chloro-N-[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)methylimino]benzamide (PubChem CID 121370129) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 4-chloro-N-[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)methylimino]benzamide.
| Compound Name | 4-chloro-N-[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)methylimino]benzamide |
|---|---|
| PubChem CID | 121370129 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-chloro-N-[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)methylimino]benzamide |
| SMILES | CC(C)(C)C1=CC(=C/N=N/C(=O)c2ccc(Cl)cc2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C22H25ClN2O2/c1-21(2,3)17-11-14(12-18(19(17)26)22(4,5)6)13-24-25-20(27)15-7-9-16(23)10-8-15/h7-13H,1-6H3/b25-24+ |
| InChIKey | LPPBZQNXBPVGDZ-OCOZRVBESA-N |
| XLogP | 6.34 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|