C24H22Cl2N2O4S — CID 56847025
N'-(4-tert-butylphenyl)sulfonyl-4-chloro-N'-(4-chlorobenzoyl)benzohydrazide (PubChem CID 56847025) has the molecular formula C24H22Cl2N2O4S and a molecular weight of 505.42 g/mol. Its IUPAC name is N'-(4-tert-butylphenyl)sulfonyl-4-chloro-N'-(4-chlorobenzoyl)benzohydrazide.
| Compound Name | N'-(4-tert-butylphenyl)sulfonyl-4-chloro-N'-(4-chlorobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 56847025 |
| Molecular Formula | C24H22Cl2N2O4S |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | N'-(4-tert-butylphenyl)sulfonyl-4-chloro-N'-(4-chlorobenzoyl)benzohydrazide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N(NC(=O)c2ccc(Cl)cc2)C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O4S/c1-24(2,3)18-8-14-21(15-9-18)33(31,32)28(23(30)17-6-12-20(26)13-7-17)27-22(29)16-4-10-19(25)11-5-16/h4-15H,1-3H3,(H,27,29) |
| InChIKey | LDXIHGIEGAPUPF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|