C31H25Cl3N2O5S — CID 56847024
N'-(4-tert-butylphenyl)sulfonyl-4-chloro-N,N'-bis(4-chlorobenzoyl)benzohydrazide (PubChem CID 56847024) has the molecular formula C31H25Cl3N2O5S and a molecular weight of 643.98 g/mol. Its IUPAC name is N'-(4-tert-butylphenyl)sulfonyl-4-chloro-N,N'-bis(4-chlorobenzoyl)benzohydrazide.
| Compound Name | N'-(4-tert-butylphenyl)sulfonyl-4-chloro-N,N'-bis(4-chlorobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 56847024 |
| Molecular Formula | C31H25Cl3N2O5S |
| Molecular Weight | 643.98 g/mol |
| Exact Mass | 642.05 |
| IUPAC Name | N'-(4-tert-butylphenyl)sulfonyl-4-chloro-N,N'-bis(4-chlorobenzoyl)benzohydrazide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N(C(=O)c2ccc(Cl)cc2)N(C(=O)c2ccc(Cl)cc2)C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C31H25Cl3N2O5S/c1-31(2,3)23-10-18-27(19-11-23)42(40,41)36(30(39)22-8-16-26(34)17-9-22)35(28(37)20-4-12-24(32)13-5-20)29(38)21-6-14-25(33)15-7-21/h4-19H,1-3H3 |
| InChIKey | QOQGNSISCUCQIS-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.98 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|