C38H39N7O7 — CID 121371893
5-methoxy-4-[5-[4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]pentoxy]-2-nitrobenzoic acid (PubChem CID 121371893) has the molecular formula C38H39N7O7 and a molecular weight of 705.77 g/mol. Its IUPAC name is 5-methoxy-4-[5-[4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]pentoxy]-2-nitrobenzoic acid.
| Compound Name | 5-methoxy-4-[5-[4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]pentoxy]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 121371893 |
| Molecular Formula | C38H39N7O7 |
| Molecular Weight | 705.77 g/mol |
| Exact Mass | 705.29 |
| IUPAC Name | 5-methoxy-4-[5-[4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]pentoxy]-2-nitrobenzoic acid |
| SMILES | COc1cc(C(=O)O)c([N+](=O)[O-])cc1OCCCCCOc1ccc(-c2nc3ccc(-c4nc5ccc(N6CCN(C)CC6)cc5[nH]4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C38H39N7O7/c1-43-14-16-44(17-15-43)26-9-13-30-32(21-26)42-37(40-30)25-8-12-29-31(20-25)41-36(39-29)24-6-10-27(11-7-24)51-18-4-3-5-19-52-35-23-33(45(48)49)28(38(46)47)22-34(35)50-2/h6-13,20-23H,3-5,14-19H2,1-2H3,(H,39,41)(H,40,42)(H,46,47) |
| InChIKey | UKZGTVYPKSURMD-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 171.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.77 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|