C15H24BrN3O3 — CID 121373082
tert-butyl 3-bromo-1-(oxolan-3-yl)-3,4,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine-5-carboxylate (PubChem CID 121373082) has the molecular formula C15H24BrN3O3 and a molecular weight of 374.28 g/mol. Its IUPAC name is tert-butyl 3-bromo-1-(oxolan-3-yl)-3,4,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 3-bromo-1-(oxolan-3-yl)-3,4,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 121373082 |
| Molecular Formula | C15H24BrN3O3 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | tert-butyl 3-bromo-1-(oxolan-3-yl)-3,4,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C(Br)NN2C1CCOC1 |
| InChI | InChI=1S/C15H24BrN3O3/c1-15(2,3)22-14(20)18-6-4-12-11(8-18)13(16)17-19(12)10-5-7-21-9-10/h10,13,17H,4-9H2,1-3H3 |
| InChIKey | WLZMIMCDTYKBIC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|