C15H22IN3O3 — CID 90292752
tert-butyl 3-[3-iodo-1-(oxolan-3-yl)pyrazol-5-yl]azetidine-1-carboxylate (PubChem CID 90292752) has the molecular formula C15H22IN3O3 and a molecular weight of 419.26 g/mol. Its IUPAC name is tert-butyl 3-[3-iodo-1-(oxolan-3-yl)pyrazol-5-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-iodo-1-(oxolan-3-yl)pyrazol-5-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 90292752 |
| Molecular Formula | C15H22IN3O3 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | tert-butyl 3-[3-iodo-1-(oxolan-3-yl)pyrazol-5-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2cc(I)nn2C2CCOC2)C1 |
| InChI | InChI=1S/C15H22IN3O3/c1-15(2,3)22-14(20)18-7-10(8-18)12-6-13(16)17-19(12)11-4-5-21-9-11/h6,10-11H,4-5,7-9H2,1-3H3 |
| InChIKey | NUNOTVUDGXAYJR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|