C16H21IN2O3 — CID 146646843
tert-butyl 4-iodo-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxylate (PubChem CID 146646843) has the molecular formula C16H21IN2O3 and a molecular weight of 416.26 g/mol. Its IUPAC name is tert-butyl 4-iodo-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxylate.
| Compound Name | tert-butyl 4-iodo-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxylate |
|---|---|
| PubChem CID | 146646843 |
| Molecular Formula | C16H21IN2O3 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | tert-butyl 4-iodo-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(C1)c1cc(I)cc(=O)n1C2 |
| InChI | InChI=1S/C16H21IN2O3/c1-16(2,3)22-15(21)18-7-10-4-11(9-18)13-5-12(17)6-14(20)19(13)8-10/h5-6,10-11H,4,7-9H2,1-3H3 |
| InChIKey | GCTGYAOXNNHUJT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|