C17H24N2O3 — CID 68807074
tert-butyl 5-methyl-6-oxo-5,11-diazatricyclo[7.3.1.02,7]trideca-2(7),3-diene-11-carboxylate (PubChem CID 68807074) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl 5-methyl-6-oxo-5,11-diazatricyclo[7.3.1.02,7]trideca-2(7),3-diene-11-carboxylate.
| Compound Name | tert-butyl 5-methyl-6-oxo-5,11-diazatricyclo[7.3.1.02,7]trideca-2(7),3-diene-11-carboxylate |
|---|---|
| PubChem CID | 68807074 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl 5-methyl-6-oxo-5,11-diazatricyclo[7.3.1.02,7]trideca-2(7),3-diene-11-carboxylate |
| SMILES | Cn1ccc2c(c1=O)CC1CC2CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H24N2O3/c1-17(2,3)22-16(21)19-9-11-7-12(10-19)13-5-6-18(4)15(20)14(13)8-11/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | HLRBNAGHGBJJDL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|