C12H16N2O — CID 11275735
(1R)-5-methyl-5,11-diazatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one (PubChem CID 11275735) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (1R)-5-methyl-5,11-diazatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one.
| Compound Name | (1R)-5-methyl-5,11-diazatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one |
|---|---|
| PubChem CID | 11275735 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (1R)-5-methyl-5,11-diazatricyclo[7.3.1.02,7]trideca-2(7),3-dien-6-one |
| SMILES | Cn1ccc2c(c1=O)CC1CNC[C@@H]2C1 |
| InChI | InChI=1S/C12H16N2O/c1-14-3-2-10-9-4-8(6-13-7-9)5-11(10)12(14)15/h2-3,8-9,13H,4-7H2,1H3/t8?,9-/m0/s1 |
| InChIKey | IJOFSDDRDHZFNT-GKAPJAKFSA-N |
| XLogP | 0.63 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|