C16H20BrIN2O3 — CID 153497010
tert-butyl (1S)-5-bromo-4-iodo-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxylate (PubChem CID 153497010) has the molecular formula C16H20BrIN2O3 and a molecular weight of 495.16 g/mol. Its IUPAC name is tert-butyl (1S)-5-bromo-4-iodo-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxylate.
| Compound Name | tert-butyl (1S)-5-bromo-4-iodo-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxylate |
|---|---|
| PubChem CID | 153497010 |
| Molecular Formula | C16H20BrIN2O3 |
| Molecular Weight | 495.16 g/mol |
| Exact Mass | 493.97 |
| IUPAC Name | tert-butyl (1S)-5-bromo-4-iodo-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2C[C@@H](C1)c1cc(I)c(Br)c(=O)n1C2 |
| InChI | InChI=1S/C16H20BrIN2O3/c1-16(2,3)23-15(22)19-6-9-4-10(8-19)12-5-11(18)13(17)14(21)20(12)7-9/h5,9-10H,4,6-8H2,1-3H3/t9?,10-/m0/s1 |
| InChIKey | XRWPSHYPUXGYID-AXDSSHIGSA-N |
| XLogP | 3.57 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.16 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|