C27H34F2N6OS — CID 121373565
3-[7-(difluoromethyl)-6-(2,4-dimethyl-1,3-thiazol-5-yl)-3,4-dihydro-2H-quinolin-1-yl]-N-methyl-1-(oxan-4-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-amine (PubChem CID 121373565) has the molecular formula C27H34F2N6OS and a molecular weight of 528.67 g/mol. Its IUPAC name is 3-[7-(difluoromethyl)-6-(2,4-dimethyl-1,3-thiazol-5-yl)-3,4-dihydro-2H-quinolin-1-yl]-N-methyl-1-(oxan-4-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-amine.
| Compound Name | 3-[7-(difluoromethyl)-6-(2,4-dimethyl-1,3-thiazol-5-yl)-3,4-dihydro-2H-quinolin-1-yl]-N-methyl-1-(oxan-4-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-amine |
|---|---|
| PubChem CID | 121373565 |
| Molecular Formula | C27H34F2N6OS |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 3-[7-(difluoromethyl)-6-(2,4-dimethyl-1,3-thiazol-5-yl)-3,4-dihydro-2H-quinolin-1-yl]-N-methyl-1-(oxan-4-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-amine |
| SMILES | CNN1CCc2c(c(N3CCCc4cc(-c5sc(C)nc5C)c(C(F)F)cc43)nn2C2CCOCC2)C1 |
| InChI | InChI=1S/C27H34F2N6OS/c1-16-25(37-17(2)31-16)20-13-18-5-4-9-34(24(18)14-21(20)26(28)29)27-22-15-33(30-3)10-6-23(22)35(32-27)19-7-11-36-12-8-19/h13-14,19,26,30H,4-12,15H2,1-3H3 |
| InChIKey | QXDNLZJAOSBKRH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|