C19H23N — CID 121373932
(2Z,4E)-3-tert-butyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)penta-2,4-dienenitrile (PubChem CID 121373932) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is (2Z,4E)-3-tert-butyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)penta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-3-tert-butyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 121373932 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (2Z,4E)-3-tert-butyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)penta-2,4-dienenitrile |
| SMILES | CC(C)(C)C(=C\C#N)/C=C/c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H23N/c1-19(2,3)18(12-13-20)11-9-15-8-10-16-6-4-5-7-17(16)14-15/h8-12,14H,4-7H2,1-3H3/b11-9+,18-12- |
| InChIKey | CBGAAFFAJHLLPN-NEAXLJNESA-N |
| XLogP | 5.07 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|