C24H38O10 — CID 121375656
3,4-bis[1-[1-(1-ethoxyethoxy)ethoxy]ethyl]phthalic acid (PubChem CID 121375656) has the molecular formula C24H38O10 and a molecular weight of 486.56 g/mol. Its IUPAC name is 3,4-bis[1-[1-(1-ethoxyethoxy)ethoxy]ethyl]phthalic acid.
| Compound Name | 3,4-bis[1-[1-(1-ethoxyethoxy)ethoxy]ethyl]phthalic acid |
|---|---|
| PubChem CID | 121375656 |
| Molecular Formula | C24H38O10 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 3,4-bis[1-[1-(1-ethoxyethoxy)ethoxy]ethyl]phthalic acid |
| SMILES | CCOC(C)OC(C)OC(C)c1ccc(C(=O)O)c(C(=O)O)c1C(C)OC(C)OC(C)OCC |
| InChI | InChI=1S/C24H38O10/c1-9-29-15(5)33-17(7)31-13(3)19-11-12-20(23(25)26)22(24(27)28)21(19)14(4)32-18(8)34-16(6)30-10-2/h11-18H,9-10H2,1-8H3,(H,25,26)(H,27,28) |
| InChIKey | QVXVANRBACNBSK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|