C24H38O8 — CID 121375638
2,3-bis[1-(1-butoxyethoxy)ethyl]terephthalic acid (PubChem CID 121375638) has the molecular formula C24H38O8 and a molecular weight of 454.56 g/mol. Its IUPAC name is 2,3-bis[1-(1-butoxyethoxy)ethyl]terephthalic acid.
| Compound Name | 2,3-bis[1-(1-butoxyethoxy)ethyl]terephthalic acid |
|---|---|
| PubChem CID | 121375638 |
| Molecular Formula | C24H38O8 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 2,3-bis[1-(1-butoxyethoxy)ethyl]terephthalic acid |
| SMILES | CCCCOC(C)OC(C)c1c(C(=O)O)ccc(C(=O)O)c1C(C)OC(C)OCCCC |
| InChI | InChI=1S/C24H38O8/c1-7-9-13-29-17(5)31-15(3)21-19(23(25)26)11-12-20(24(27)28)22(21)16(4)32-18(6)30-14-10-8-2/h11-12,15-18H,7-10,13-14H2,1-6H3,(H,25,26)(H,27,28) |
| InChIKey | JRQAIBKRFDEMAV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|