C20H30O8 — CID 121376026
bis[1-(1-ethoxyethoxy)ethyl] benzene-1,3-dicarboxylate (PubChem CID 121376026) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is bis[1-(1-ethoxyethoxy)ethyl] benzene-1,3-dicarboxylate.
| Compound Name | bis[1-(1-ethoxyethoxy)ethyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 121376026 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | bis[1-(1-ethoxyethoxy)ethyl] benzene-1,3-dicarboxylate |
| SMILES | CCOC(C)OC(C)OC(=O)c1cccc(C(=O)OC(C)OC(C)OCC)c1 |
| InChI | InChI=1S/C20H30O8/c1-7-23-13(3)25-15(5)27-19(21)17-10-9-11-18(12-17)20(22)28-16(6)26-14(4)24-8-2/h9-16H,7-8H2,1-6H3 |
| InChIKey | FSNJEHSEKRYMAJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|