C15H13F2N3O — CID 121377064
N-[(1S,2S)-2-(2,4-difluorophenyl)cyclobutyl]pyrimidine-2-carboxamide (PubChem CID 121377064) has the molecular formula C15H13F2N3O and a molecular weight of 289.28 g/mol. Its IUPAC name is N-[(1S,2S)-2-(2,4-difluorophenyl)cyclobutyl]pyrimidine-2-carboxamide.
| Compound Name | N-[(1S,2S)-2-(2,4-difluorophenyl)cyclobutyl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 121377064 |
| Molecular Formula | C15H13F2N3O |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[(1S,2S)-2-(2,4-difluorophenyl)cyclobutyl]pyrimidine-2-carboxamide |
| SMILES | O=C(N[C@H]1CC[C@H]1c1ccc(F)cc1F)c1ncccn1 |
| InChI | InChI=1S/C15H13F2N3O/c16-9-2-3-10(12(17)8-9)11-4-5-13(11)20-15(21)14-18-6-1-7-19-14/h1-3,6-8,11,13H,4-5H2,(H,20,21)/t11-,13-/m0/s1 |
| InChIKey | VZNLSXGSHXGMRA-AAEUAGOBSA-N |
| XLogP | 2.43 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |