C12H22N4O6S — CID 121378175
formamide;[(5R)-7-oxo-5-piperidin-4-yl-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 121378175) has the molecular formula C12H22N4O6S and a molecular weight of 350.40 g/mol. Its IUPAC name is formamide;[(5R)-7-oxo-5-piperidin-4-yl-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | formamide;[(5R)-7-oxo-5-piperidin-4-yl-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 121378175 |
| Molecular Formula | C12H22N4O6S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | formamide;[(5R)-7-oxo-5-piperidin-4-yl-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC=O.O=C1N2CCC[C@@](C3CCNCC3)(C2)N1OS(=O)(=O)O |
| InChI | InChI=1S/C11H19N3O5S.CH3NO/c15-10-13-7-1-4-11(8-13,9-2-5-12-6-3-9)14(10)19-20(16,17)18;2-1-3/h9,12H,1-8H2,(H,16,17,18);1H,(H2,2,3)/t11-;/m0./s1 |
| InChIKey | HTYAGUAXJDXVCL-MERQFXBCSA-N |
| XLogP | -0.91 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|