C12H22N4O6S — CID 144802707
(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;N-piperidin-4-ylformamide (PubChem CID 144802707) has the molecular formula C12H22N4O6S and a molecular weight of 350.40 g/mol. Its IUPAC name is (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;N-piperidin-4-ylformamide.
| Compound Name | (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;N-piperidin-4-ylformamide |
|---|---|
| PubChem CID | 144802707 |
| Molecular Formula | C12H22N4O6S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;N-piperidin-4-ylformamide |
| SMILES | O=C1N2CCCC(C2)N1OS(=O)(=O)O.O=CNC1CCNCC1 |
| InChI | InChI=1S/C6H10N2O5S.C6H12N2O/c9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12;9-5-8-6-1-3-7-4-2-6/h5H,1-4H2,(H,10,11,12);5-7H,1-4H2,(H,8,9) |
| InChIKey | AGNBRELZIACMLP-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|