C13H26N4O7S — CID 144836927
N-methoxyformamide;2-methylpyrrolidine;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 144836927) has the molecular formula C13H26N4O7S and a molecular weight of 382.44 g/mol. Its IUPAC name is N-methoxyformamide;2-methylpyrrolidine;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | N-methoxyformamide;2-methylpyrrolidine;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 144836927 |
| Molecular Formula | C13H26N4O7S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-methoxyformamide;2-methylpyrrolidine;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC1CCCN1.CONC=O.O=C1N2CCC[C@H](C2)N1OS(=O)(=O)O |
| InChI | InChI=1S/C6H10N2O5S.C5H11N.C2H5NO2/c9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12;1-5-3-2-4-6-5;1-5-3-2-4/h5H,1-4H2,(H,10,11,12);5-6H,2-4H2,1H3;2H,1H3,(H,3,4)/t5-;;/m1../s1 |
| InChIKey | HFWXSEBXVPYRHW-ZJIMSODOSA-N |
| XLogP | -0.33 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|