C12H23N5O7S — CID 144582171
N-methyl-N-(pyrrolidin-2-ylmethoxy)nitrous amide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate (PubChem CID 144582171) has the molecular formula C12H23N5O7S and a molecular weight of 381.41 g/mol. Its IUPAC name is N-methyl-N-(pyrrolidin-2-ylmethoxy)nitrous amide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate.
| Compound Name | N-methyl-N-(pyrrolidin-2-ylmethoxy)nitrous amide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 144582171 |
| Molecular Formula | C12H23N5O7S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-methyl-N-(pyrrolidin-2-ylmethoxy)nitrous amide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
| SMILES | CN(N=O)OCC1CCCN1.O=C1N2CCCC(C2)N1OS(=O)(=O)O |
| InChI | InChI=1S/C6H13N3O2.C6H10N2O5S/c1-9(8-10)11-5-6-3-2-4-7-6;9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12/h6-7H,2-5H2,1H3;5H,1-4H2,(H,10,11,12) |
| InChIKey | RLFRMRWCVGROHP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|