C13H26N8O7S — CID 145325908
N-[[(2R)-4-[amino-[(Z)-aminomethylideneamino]amino]pyrrolidin-2-yl]methoxy]formamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate (PubChem CID 145325908) has the molecular formula C13H26N8O7S and a molecular weight of 438.47 g/mol. Its IUPAC name is N-[[(2R)-4-[amino-[(Z)-aminomethylideneamino]amino]pyrrolidin-2-yl]methoxy]formamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate.
| Compound Name | N-[[(2R)-4-[amino-[(Z)-aminomethylideneamino]amino]pyrrolidin-2-yl]methoxy]formamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 145325908 |
| Molecular Formula | C13H26N8O7S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[[(2R)-4-[amino-[(Z)-aminomethylideneamino]amino]pyrrolidin-2-yl]methoxy]formamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
| SMILES | N/C=N\N(N)C1CN[C@@H](CONC=O)C1.O=C1N2CCCC(C2)N1OS(=O)(=O)O |
| InChI | InChI=1S/C7H16N6O2.C6H10N2O5S/c8-4-11-13(9)7-1-6(10-2-7)3-15-12-5-14;9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12/h4-7,10H,1-3,9H2,(H2,8,11)(H,12,14);5H,1-4H2,(H,10,11,12)/t6-,7?;/m1./s1 |
| InChIKey | PPSLKSJDWVIFDR-JVEOKNEYSA-N |
| XLogP | -2.91 |
| TPSA | 205.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|