C17H33N5O7S — CID 145325940
(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine;N-(pyrrolidin-2-ylmethoxy)formamide (PubChem CID 145325940) has the molecular formula C17H33N5O7S and a molecular weight of 451.55 g/mol. Its IUPAC name is (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine;N-(pyrrolidin-2-ylmethoxy)formamide.
| Compound Name | (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine;N-(pyrrolidin-2-ylmethoxy)formamide |
|---|---|
| PubChem CID | 145325940 |
| Molecular Formula | C17H33N5O7S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | (7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate;piperidine;N-(pyrrolidin-2-ylmethoxy)formamide |
| SMILES | C1CCNCC1.O=C1N2CCCC(C2)N1OS(=O)(=O)O.O=CNOCC1CCCN1 |
| InChI | InChI=1S/C6H10N2O5S.C6H12N2O2.C5H11N/c9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12;9-5-8-10-4-6-2-1-3-7-6;1-2-4-6-5-3-1/h5H,1-4H2,(H,10,11,12);5-7H,1-4H2,(H,8,9);6H,1-5H2 |
| InChIKey | AUOAOXZGUZDMMK-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 149.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|