C16H29N5O8S — CID 145325944
N-[[(2R)-4-morpholin-4-ylpyrrolidin-2-yl]methoxy]formamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate (PubChem CID 145325944) has the molecular formula C16H29N5O8S and a molecular weight of 451.50 g/mol. Its IUPAC name is N-[[(2R)-4-morpholin-4-ylpyrrolidin-2-yl]methoxy]formamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate.
| Compound Name | N-[[(2R)-4-morpholin-4-ylpyrrolidin-2-yl]methoxy]formamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 145325944 |
| Molecular Formula | C16H29N5O8S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-[[(2R)-4-morpholin-4-ylpyrrolidin-2-yl]methoxy]formamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
| SMILES | O=C1N2CCCC(C2)N1OS(=O)(=O)O.O=CNOC[C@H]1CC(N2CCOCC2)CN1 |
| InChI | InChI=1S/C10H19N3O3.C6H10N2O5S/c14-8-12-16-7-9-5-10(6-11-9)13-1-3-15-4-2-13;9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12/h8-11H,1-7H2,(H,12,14);5H,1-4H2,(H,10,11,12)/t9-,10?;/m1./s1 |
| InChIKey | WIIRYAVJEBNBNF-UVUXOWFKSA-N |
| XLogP | -1.65 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|