C16H27N5O8S — CID 137407613
[(2S,5R)-2-[[(2R,4R)-4-morpholin-4-ylpyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 137407613) has the molecular formula C16H27N5O8S and a molecular weight of 449.49 g/mol. Its IUPAC name is [(2S,5R)-2-[[(2R,4R)-4-morpholin-4-ylpyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[[(2R,4R)-4-morpholin-4-ylpyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 137407613 |
| Molecular Formula | C16H27N5O8S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | [(2S,5R)-2-[[(2R,4R)-4-morpholin-4-ylpyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NOC[C@H]1C[C@@H](N2CCOCC2)CN1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C16H27N5O8S/c22-15(14-2-1-12-9-20(14)16(23)21(12)29-30(24,25)26)18-28-10-11-7-13(8-17-11)19-3-5-27-6-4-19/h11-14,17H,1-10H2,(H,18,22)(H,24,25,26)/t11-,12-,13-,14+/m1/s1 |
| InChIKey | LQEZYIKLOQRBRQ-SYQHCUMBSA-N |
| XLogP | -1.90 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|